C7H9ClF5N3 — CID 87805106
4-chloro-3-(1,1,2,2,2-pentafluoroethyl)-2-propan-2-yl-3H-1,2,4-triazole (PubChem CID 87805106) has the molecular formula C7H9ClF5N3 and a molecular weight of 265.61 g/mol. Its IUPAC name is 4-chloro-3-(1,1,2,2,2-pentafluoroethyl)-2-propan-2-yl-3H-1,2,4-triazole.
| Compound Name | 4-chloro-3-(1,1,2,2,2-pentafluoroethyl)-2-propan-2-yl-3H-1,2,4-triazole |
|---|---|
| PubChem CID | 87805106 |
| Molecular Formula | C7H9ClF5N3 |
| Molecular Weight | 265.61 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 4-chloro-3-(1,1,2,2,2-pentafluoroethyl)-2-propan-2-yl-3H-1,2,4-triazole |
| SMILES | CC(C)N1N=CN(Cl)C1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H9ClF5N3/c1-4(2)16-5(15(8)3-14-16)6(9,10)7(11,12)13/h3-5H,1-2H3 |
| InChIKey | ZIYRAIDWZPWWGM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|