C33H52O4S2 — CID 87857169
2-[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-ethyl-methyl-λ4-sulfanyl]phenoxy]acetic acid (PubChem CID 87857169) has the molecular formula C33H52O4S2 and a molecular weight of 576.91 g/mol. Its IUPAC name is 2-[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-ethyl-methyl-λ4-sulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-ethyl-methyl-λ4-sulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 87857169 |
| Molecular Formula | C33H52O4S2 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | 2-[2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)sulfanyl-ethyl-methyl-λ4-sulfanyl]phenoxy]acetic acid |
| SMILES | CCS(C)(Sc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1cc(C(C)(C)C)c(OCC(=O)O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H52O4S2/c1-15-39(14,38-21-16-23(30(2,3)4)28(36)24(17-21)31(5,6)7)22-18-25(32(8,9)10)29(37-20-27(34)35)26(19-22)33(11,12)13/h16-19,36H,15,20H2,1-14H3,(H,34,35) |
| InChIKey | VWOSJDRZBYYKAM-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|