C16H21N3Ni — CID 87859710
(2,6-diethylphenyl)iminonickel;2-ethylpyrimidine (PubChem CID 87859710) has the molecular formula C16H21N3Ni and a molecular weight of 314.06 g/mol. Its IUPAC name is (2,6-diethylphenyl)iminonickel;2-ethylpyrimidine.
| Compound Name | (2,6-diethylphenyl)iminonickel;2-ethylpyrimidine |
|---|---|
| PubChem CID | 87859710 |
| Molecular Formula | C16H21N3Ni |
| Molecular Weight | 314.06 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2,6-diethylphenyl)iminonickel;2-ethylpyrimidine |
| SMILES | CCc1cccc(CC)c1N=[Ni].CCc1ncccn1 |
| InChI | InChI=1S/C10H13N.C6H8N2.Ni/c1-3-8-6-5-7-9(4-2)10(8)11;1-2-6-7-4-3-5-8-6;/h5-7H,3-4H2,1-2H3;3-5H,2H2,1H3; |
| InChIKey | VYSFERJXIIPPMJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.06 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |