C6H6F7O4P — CID 87919088
4-(1,1,2,2,3,3,4-heptafluorobutyl)-2-hydroxy-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 87919088) has the molecular formula C6H6F7O4P and a molecular weight of 306.07 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4-heptafluorobutyl)-2-hydroxy-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 4-(1,1,2,2,3,3,4-heptafluorobutyl)-2-hydroxy-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 87919088 |
| Molecular Formula | C6H6F7O4P |
| Molecular Weight | 306.07 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 4-(1,1,2,2,3,3,4-heptafluorobutyl)-2-hydroxy-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | O=P1(O)OCC(C(F)(F)C(F)(F)C(F)(F)CF)O1 |
| InChI | InChI=1S/C6H6F7O4P/c7-2-4(8,9)6(12,13)5(10,11)3-1-16-18(14,15)17-3/h3H,1-2H2,(H,14,15) |
| InChIKey | WUGNMZRVHXOVCC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.07 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|