C34H30O6S2 — CID 87921488
[2-[2-[1-(4-methylphenyl)sulfonyloxy-1H-inden-2-yl]ethyl]-1H-inden-1-yl] 4-methylbenzenesulfonate (PubChem CID 87921488) has the molecular formula C34H30O6S2 and a molecular weight of 598.74 g/mol. Its IUPAC name is [2-[2-[1-(4-methylphenyl)sulfonyloxy-1H-inden-2-yl]ethyl]-1H-inden-1-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-[2-[1-(4-methylphenyl)sulfonyloxy-1H-inden-2-yl]ethyl]-1H-inden-1-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87921488 |
| Molecular Formula | C34H30O6S2 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | [2-[2-[1-(4-methylphenyl)sulfonyloxy-1H-inden-2-yl]ethyl]-1H-inden-1-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C(CCC3=Cc4ccccc4C3OS(=O)(=O)c3ccc(C)cc3)=Cc3ccccc32)cc1 |
| InChI | InChI=1S/C34H30O6S2/c1-23-11-17-29(18-12-23)41(35,36)39-33-27(21-25-7-3-5-9-31(25)33)15-16-28-22-26-8-4-6-10-32(26)34(28)40-42(37,38)30-19-13-24(2)14-20-30/h3-14,17-22,33-34H,15-16H2,1-2H3 |
| InChIKey | CZDFLNRVRUJMEI-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|