C20H32N2O8 — CID 87949596
6-carbamoyloxyhexyl carbamate;bis(ethenyl 2-methylprop-2-enoate) (PubChem CID 87949596) has the molecular formula C20H32N2O8 and a molecular weight of 428.48 g/mol. Its IUPAC name is 6-carbamoyloxyhexyl carbamate;bis(ethenyl 2-methylprop-2-enoate).
| Compound Name | 6-carbamoyloxyhexyl carbamate;bis(ethenyl 2-methylprop-2-enoate) |
|---|---|
| PubChem CID | 87949596 |
| Molecular Formula | C20H32N2O8 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 6-carbamoyloxyhexyl carbamate;bis(ethenyl 2-methylprop-2-enoate) |
| SMILES | C=COC(=O)C(=C)C.C=COC(=O)C(=C)C.NC(=O)OCCCCCCOC(N)=O |
| InChI | InChI=1S/C8H16N2O4.2C6H8O2/c9-7(11)13-5-3-1-2-4-6-14-8(10)12;2*1-4-8-6(7)5(2)3/h1-6H2,(H2,9,11)(H2,10,12);2*4H,1-2H2,3H3 |
| InChIKey | REQLBCSMKAZULV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|