C24H29ClFN3O3S — CID 87979796
1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]sulfanyl]-3-(3-chloro-4-fluorophenyl)urea (PubChem CID 87979796) has the molecular formula C24H29ClFN3O3S and a molecular weight of 494.03 g/mol. Its IUPAC name is 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]sulfanyl]-3-(3-chloro-4-fluorophenyl)urea.
| Compound Name | 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]sulfanyl]-3-(3-chloro-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 87979796 |
| Molecular Formula | C24H29ClFN3O3S |
| Molecular Weight | 494.03 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 1-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]sulfanyl]-3-(3-chloro-4-fluorophenyl)urea |
| SMILES | COc1ccc(C23CCC(SNC(=O)Nc4ccc(F)c(Cl)c4)CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C24H29ClFN3O3S/c1-29-11-10-24(15-4-7-20(31-2)21(12-15)32-3)9-8-17(14-22(24)29)33-28-23(30)27-16-5-6-19(26)18(25)13-16/h4-7,12-13,17,22H,8-11,14H2,1-3H3,(H2,27,28,30) |
| InChIKey | AHPSBHLNKPMEBU-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.03 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|