C20H26BrN2O2+ — CID 8810459
(5-bromo-2-methoxyphenyl)methyl-methyl-[2-oxo-2-(N-propan-2-ylanilino)ethyl]azanium (PubChem CID 8810459) has the molecular formula C20H26BrN2O2+ and a molecular weight of 406.34 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-methyl-[2-oxo-2-(N-propan-2-ylanilino)ethyl]azanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-methyl-[2-oxo-2-(N-propan-2-ylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8810459 |
| Molecular Formula | C20H26BrN2O2+ |
| Molecular Weight | 406.34 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-methyl-[2-oxo-2-(N-propan-2-ylanilino)ethyl]azanium |
| SMILES | COc1ccc(Br)cc1C[NH+](C)CC(=O)N(c1ccccc1)C(C)C |
| InChI | InChI=1S/C20H25BrN2O2/c1-15(2)23(18-8-6-5-7-9-18)20(24)14-22(3)13-16-12-17(21)10-11-19(16)25-4/h5-12,15H,13-14H2,1-4H3/p+1 |
| InChIKey | JKAKLHDMRHKRTD-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |