C14H20N4O3S2 — CID 8823512
5-ethyl-4-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylthiophene-2-carbohydrazide (PubChem CID 8823512) has the molecular formula C14H20N4O3S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylthiophene-2-carbohydrazide.
| Compound Name | 5-ethyl-4-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylthiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 8823512 |
| Molecular Formula | C14H20N4O3S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 5-ethyl-4-methyl-N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylthiophene-2-carbohydrazide |
| SMILES | CCc1sc(C(=O)NNS(=O)(=O)c2c(C)nn(C)c2C)cc1C |
| InChI | InChI=1S/C14H20N4O3S2/c1-6-11-8(2)7-12(22-11)14(19)15-17-23(20,21)13-9(3)16-18(5)10(13)4/h7,17H,6H2,1-5H3,(H,15,19) |
| InChIKey | DBENAESCNUJWTC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|