C20H37NaO5S — CID 88512777
sodium 5,12-diethyl-7,10-dioxohexadecane-8-sulfonate (PubChem CID 88512777) has the molecular formula C20H37NaO5S and a molecular weight of 412.57 g/mol. Its IUPAC name is sodium 5,12-diethyl-7,10-dioxohexadecane-8-sulfonate.
| Compound Name | sodium 5,12-diethyl-7,10-dioxohexadecane-8-sulfonate |
|---|---|
| PubChem CID | 88512777 |
| Molecular Formula | C20H37NaO5S |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | sodium 5,12-diethyl-7,10-dioxohexadecane-8-sulfonate |
| SMILES | CCCCC(CC)CC(=O)CC(C(=O)CC(CC)CCCC)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H38O5S.Na/c1-5-9-11-16(7-3)13-18(21)15-20(26(23,24)25)19(22)14-17(8-4)12-10-6-2;/h16-17,20H,5-15H2,1-4H3,(H,23,24,25);/q;+1/p-1 |
| InChIKey | JVEREVZTPUUPRF-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|