C13H30Cl2N4O4 — CID 88519806
[3-amino-3-(2-aminoethyl)-5-(ethylcarbamoyloxy)pentyl] N-ethylcarbamate;dihydrochloride (PubChem CID 88519806) has the molecular formula C13H30Cl2N4O4 and a molecular weight of 377.31 g/mol. Its IUPAC name is [3-amino-3-(2-aminoethyl)-5-(ethylcarbamoyloxy)pentyl] N-ethylcarbamate;dihydrochloride.
| Compound Name | [3-amino-3-(2-aminoethyl)-5-(ethylcarbamoyloxy)pentyl] N-ethylcarbamate;dihydrochloride |
|---|---|
| PubChem CID | 88519806 |
| Molecular Formula | C13H30Cl2N4O4 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [3-amino-3-(2-aminoethyl)-5-(ethylcarbamoyloxy)pentyl] N-ethylcarbamate;dihydrochloride |
| SMILES | CCNC(=O)OCCC(N)(CCN)CCOC(=O)NCC.Cl.Cl |
| InChI | InChI=1S/C13H28N4O4.2ClH/c1-3-16-11(18)20-9-6-13(15,5-8-14)7-10-21-12(19)17-4-2;;/h3-10,14-15H2,1-2H3,(H,16,18)(H,17,19);2*1H |
| InChIKey | FCURHSAJDGRVFC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |