C13H28N4O2 — CID 88553411
N,N'-bis(3-aminopropyl)-2,2,3-trimethylbutanediamide (PubChem CID 88553411) has the molecular formula C13H28N4O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is N,N'-bis(3-aminopropyl)-2,2,3-trimethylbutanediamide.
| Compound Name | N,N'-bis(3-aminopropyl)-2,2,3-trimethylbutanediamide |
|---|---|
| PubChem CID | 88553411 |
| Molecular Formula | C13H28N4O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.22 |
| IUPAC Name | N,N'-bis(3-aminopropyl)-2,2,3-trimethylbutanediamide |
| SMILES | CC(C(=O)NCCCN)C(C)(C)C(=O)NCCCN |
| InChI | InChI=1S/C13H28N4O2/c1-10(11(18)16-8-4-6-14)13(2,3)12(19)17-9-5-7-15/h10H,4-9,14-15H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | CSMGWFNFESNFBC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|