C16H14N2O4 — CID 88567577
(E)-1-(1,3-benzodioxol-5-yl)-N-[(4-nitrosophenyl)methoxy]ethanimine (PubChem CID 88567577) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is (E)-1-(1,3-benzodioxol-5-yl)-N-[(4-nitrosophenyl)methoxy]ethanimine.
| Compound Name | (E)-1-(1,3-benzodioxol-5-yl)-N-[(4-nitrosophenyl)methoxy]ethanimine |
|---|---|
| PubChem CID | 88567577 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (E)-1-(1,3-benzodioxol-5-yl)-N-[(4-nitrosophenyl)methoxy]ethanimine |
| SMILES | C/C(=N\OCc1ccc(N=O)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14N2O4/c1-11(13-4-7-15-16(8-13)21-10-20-15)18-22-9-12-2-5-14(17-19)6-3-12/h2-8H,9-10H2,1H3/b18-11+ |
| InChIKey | METNFXBWDMFGSM-WOJGMQOQSA-N |
| XLogP | 3.75 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|