C26H30ClNO2 — CID 88584411
[(3S,8R,9S,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-chloroacetate (PubChem CID 88584411) has the molecular formula C26H30ClNO2 and a molecular weight of 423.98 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-chloroacetate.
| Compound Name | [(3S,8R,9S,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 88584411 |
| Molecular Formula | C26H30ClNO2 |
| Molecular Weight | 423.98 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | [(3S,8R,9S,10R,13S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12-octahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-chloroacetate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](OC(=O)CCl)CC[C@@]43C)C1=CC=C2c1cccnc1 |
| InChI | InChI=1S/C26H30ClNO2/c1-25-11-9-19(30-24(29)15-27)14-18(25)5-6-20-22-8-7-21(17-4-3-13-28-16-17)26(22,2)12-10-23(20)25/h3-5,7-8,13,16,19-20,23H,6,9-12,14-15H2,1-2H3/t19-,20-,23-,25-,26+/m0/s1 |
| InChIKey | HLJYZJVKIXNRHG-TUANDXLMSA-N |
| XLogP | 6.11 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.98 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|