C26H21F3N6O3S — CID 88590387
1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea (PubChem CID 88590387) has the molecular formula C26H21F3N6O3S and a molecular weight of 554.55 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 88590387 |
| Molecular Formula | C26H21F3N6O3S |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)ethyl]-3-[(E)-[4-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]phenyl]methylideneamino]thiourea |
| SMILES | CC(NC(=S)N/N=C/c1ccc(-c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H21F3N6O3S/c1-16(19-6-11-22-23(12-19)37-15-36-22)32-25(39)33-31-13-17-2-4-18(5-3-17)24-30-14-35(34-24)20-7-9-21(10-8-20)38-26(27,28)29/h2-14,16H,15H2,1H3,(H2,32,33,39)/b31-13+ |
| InChIKey | FLNTVJKHVUFNJK-IURWMYGYSA-N |
| XLogP | 5.12 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|