C26H42N4O8 — CID 88635536
[4-[2-hydroxy-3-[[2-methyl-1-[[4-(1-nitrooxyethyl)piperidine-1-carbonyl]amino]propan-2-yl]amino]propoxy]-2,3,6-trimethylphenyl] acetate (PubChem CID 88635536) has the molecular formula C26H42N4O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is [4-[2-hydroxy-3-[[2-methyl-1-[[4-(1-nitrooxyethyl)piperidine-1-carbonyl]amino]propan-2-yl]amino]propoxy]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[2-hydroxy-3-[[2-methyl-1-[[4-(1-nitrooxyethyl)piperidine-1-carbonyl]amino]propan-2-yl]amino]propoxy]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 88635536 |
| Molecular Formula | C26H42N4O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | [4-[2-hydroxy-3-[[2-methyl-1-[[4-(1-nitrooxyethyl)piperidine-1-carbonyl]amino]propan-2-yl]amino]propoxy]-2,3,6-trimethylphenyl] acetate |
| SMILES | CC(=O)Oc1c(C)cc(OCC(O)CNC(C)(C)CNC(=O)N2CCC(C(C)O[N+](=O)[O-])CC2)c(C)c1C |
| InChI | InChI=1S/C26H42N4O8/c1-16-12-23(17(2)18(3)24(16)37-20(5)31)36-14-22(32)13-28-26(6,7)15-27-25(33)29-10-8-21(9-11-29)19(4)38-30(34)35/h12,19,21-22,28,32H,8-11,13-15H2,1-7H3,(H,27,33) |
| InChIKey | BWSCBURCYXTQAS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|