C6H6Cl2N2O2S — CID 88673089
2-methoxyimino-2-(1,3-thiazol-4-yl)acetyl chloride;hydrochloride (PubChem CID 88673089) has the molecular formula C6H6Cl2N2O2S and a molecular weight of 241.10 g/mol. Its IUPAC name is 2-methoxyimino-2-(1,3-thiazol-4-yl)acetyl chloride;hydrochloride.
| Compound Name | 2-methoxyimino-2-(1,3-thiazol-4-yl)acetyl chloride;hydrochloride |
|---|---|
| PubChem CID | 88673089 |
| Molecular Formula | C6H6Cl2N2O2S |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 2-methoxyimino-2-(1,3-thiazol-4-yl)acetyl chloride;hydrochloride |
| SMILES | CON=C(C(=O)Cl)c1cscn1.Cl |
| InChI | InChI=1S/C6H5ClN2O2S.ClH/c1-11-9-5(6(7)10)4-2-12-3-8-4;/h2-3H,1H3;1H |
| InChIKey | LUZDPZJIRWRUTA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|