C10H11BrN2O3S — CID 88765756
4-bromo-3-oxo-N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]butanamide (PubChem CID 88765756) has the molecular formula C10H11BrN2O3S and a molecular weight of 319.18 g/mol. Its IUPAC name is 4-bromo-3-oxo-N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]butanamide.
| Compound Name | 4-bromo-3-oxo-N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]butanamide |
|---|---|
| PubChem CID | 88765756 |
| Molecular Formula | C10H11BrN2O3S |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 4-bromo-3-oxo-N-[(6S)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]butanamide |
| SMILES | O=C(CBr)CC(=O)NC1C(=O)N2C=CCS[C@@H]12 |
| InChI | InChI=1S/C10H11BrN2O3S/c11-5-6(14)4-7(15)12-8-9(16)13-2-1-3-17-10(8)13/h1-2,8,10H,3-5H2,(H,12,15)/t8?,10-/m0/s1 |
| InChIKey | WFMQLWCZAGEPMA-HTLJXXAVSA-N |
| XLogP | 0.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|