C14H23NO6S2 — CID 88766916
[1-hydroxy-3-methylsulfonyl-2-(propylamino)propan-2-yl] 4-methylbenzenesulfonate (PubChem CID 88766916) has the molecular formula C14H23NO6S2 and a molecular weight of 365.47 g/mol. Its IUPAC name is [1-hydroxy-3-methylsulfonyl-2-(propylamino)propan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-hydroxy-3-methylsulfonyl-2-(propylamino)propan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88766916 |
| Molecular Formula | C14H23NO6S2 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | [1-hydroxy-3-methylsulfonyl-2-(propylamino)propan-2-yl] 4-methylbenzenesulfonate |
| SMILES | CCCNC(CO)(CS(C)(=O)=O)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H23NO6S2/c1-4-9-15-14(10-16,11-22(3,17)18)21-23(19,20)13-7-5-12(2)6-8-13/h5-8,15-16H,4,9-11H2,1-3H3 |
| InChIKey | DOKAPOOASYKIKG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|