(1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate

C14H22O5S — CID 89152460

IUPAC(1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate
SMILESCCCC(C)(OS(=O)(=O)c1ccc(C)cc1)C(O)CO
InChIInChI=1S/C14H22O5S/c1-4-9-14(3,13(16)10-15)19-20(17,18)12-7-5-11(2)6-8-12/h5-8,13,15-16H,4,9-10H2,1-3H3
InChIKeyVVHBEMDRRASDBI-UHFFFAOYSA-N
MW302.39 g/mol
LogP1.61
Rot. Bonds7

About (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate

(1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate (PubChem CID 89152460) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate.

Molecular Properties

Compound Name(1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate
PubChem CID89152460
Molecular FormulaC14H22O5S
Molecular Weight302.39 g/mol
Exact Mass302.12
IUPAC Name(1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate
SMILESCCCC(C)(OS(=O)(=O)c1ccc(C)cc1)C(O)CO
InChIInChI=1S/C14H22O5S/c1-4-9-14(3,13(16)10-15)19-20(17,18)12-7-5-11(2)6-8-12/h5-8,13,15-16H,4,9-10H2,1-3H3
InChIKeyVVHBEMDRRASDBI-UHFFFAOYSA-N
XLogP1.61
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.39
LogP ≤ 51.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}

Analyze (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate?
The IUPAC name of (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate (CID 89152460) is (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate.
What is the SMILES notation for (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate?
The canonical SMILES for (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate is CCCC(C)(OS(=O)(=O)c1ccc(C)cc1)C(O)CO.
What is the InChIKey of (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate?
The InChIKey is VVHBEMDRRASDBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O5S/c1-4-9-14(3,13(16)10-15)19-20(17,18)12-7-5-11(2)6-8-12/h5-8,13,15-16H,4,9-10H2,1-3H3.
What are the key properties of (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate?
(1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate has a molecular weight of 302.39 g/mol, XLogP of 1.61, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate is sourced from PubChem (CID 89152460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).