C14H22O5S — CID 89152460
(1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate (PubChem CID 89152460) has the molecular formula C14H22O5S and a molecular weight of 302.39 g/mol. Its IUPAC name is (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89152460 |
| Molecular Formula | C14H22O5S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (1,2-dihydroxy-3-methylhexan-3-yl) 4-methylbenzenesulfonate |
| SMILES | CCCC(C)(OS(=O)(=O)c1ccc(C)cc1)C(O)CO |
| InChI | InChI=1S/C14H22O5S/c1-4-9-14(3,13(16)10-15)19-20(17,18)12-7-5-11(2)6-8-12/h5-8,13,15-16H,4,9-10H2,1-3H3 |
| InChIKey | VVHBEMDRRASDBI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|