About silver;1,2-xylene;perchlorate
silver;1,2-xylene;perchlorate (PubChem CID 88767417) has the molecular formula C8H10AgClO4
and a molecular weight of 313.49 g/mol. Its IUPAC name is silver;1,2-xylene;perchlorate.
Molecular Properties
| Compound Name | silver;1,2-xylene;perchlorate |
| PubChem CID | 88767417 |
| Molecular Formula | C8H10AgClO4 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | silver;1,2-xylene;perchlorate |
| SMILES | Cc1ccccc1C.[Ag+].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C8H10.Ag.ClHO4/c1-7-5-3-4-6-8(7)2;;2-1(3,4)5/h3-6H,1-2H3;;(H,2,3,4,5)/q;+1;/p-1 |
| InChIKey | BUYXLHNAKOWJTO-UHFFFAOYSA-M |
| XLogP | -2.46 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze silver;1,2-xylene;perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;1,2-xylene;perchlorate?
The IUPAC name of silver;1,2-xylene;perchlorate (CID 88767417) is silver;1,2-xylene;perchlorate.
What is the SMILES notation for silver;1,2-xylene;perchlorate?
The canonical SMILES for silver;1,2-xylene;perchlorate is Cc1ccccc1C.[Ag+].[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of silver;1,2-xylene;perchlorate?
The InChIKey is BUYXLHNAKOWJTO-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10.Ag.ClHO4/c1-7-5-3-4-6-8(7)2;;2-1(3,4)5/h3-6H,1-2H3;;(H,2,3,4,5)/q;+1;/p-1.
What are the key properties of silver;1,2-xylene;perchlorate?
silver;1,2-xylene;perchlorate has a molecular weight of 313.49 g/mol, XLogP of -2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for silver;1,2-xylene;perchlorate is sourced from PubChem (CID 88767417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).