C8H10AgClO4 — CID 88767417
silver;1,2-xylene;perchlorate (PubChem CID 88767417) has the molecular formula C8H10AgClO4 and a molecular weight of 313.49 g/mol. Its IUPAC name is silver;1,2-xylene;perchlorate.
| Compound Name | silver;1,2-xylene;perchlorate |
|---|---|
| PubChem CID | 88767417 |
| Molecular Formula | C8H10AgClO4 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | silver;1,2-xylene;perchlorate |
| SMILES | Cc1ccccc1C.[Ag+].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C8H10.Ag.ClHO4/c1-7-5-3-4-6-8(7)2;;2-1(3,4)5/h3-6H,1-2H3;;(H,2,3,4,5)/q;+1;/p-1 |
| InChIKey | BUYXLHNAKOWJTO-UHFFFAOYSA-M |
| XLogP | -2.46 |
| TPSA | 92.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |