C9H14N6O2S — CID 88781852
3-amino-N-[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethyl]-3-imino-2-methylpropanamide (PubChem CID 88781852) has the molecular formula C9H14N6O2S and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-amino-N-[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethyl]-3-imino-2-methylpropanamide.
| Compound Name | 3-amino-N-[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethyl]-3-imino-2-methylpropanamide |
|---|---|
| PubChem CID | 88781852 |
| Molecular Formula | C9H14N6O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-amino-N-[2-amino-1-(2-amino-1,3-thiazol-4-yl)-2-oxoethyl]-3-imino-2-methylpropanamide |
| SMILES | [H]/N=C(\N)C(C)C(=O)NC(C(N)=O)c1csc(N)n1 |
| InChI | InChI=1S/C9H14N6O2S/c1-3(6(10)11)8(17)15-5(7(12)16)4-2-18-9(13)14-4/h2-3,5H,1H3,(H3,10,11)(H2,12,16)(H2,13,14)(H,15,17) |
| InChIKey | YOLXFROEOIOLBF-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 160.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|