C9H6Cl3FN2OS — CID 88814163
2-fluoro-N-[(2,3,4-trichlorophenyl)carbamothioyl]acetamide (PubChem CID 88814163) has the molecular formula C9H6Cl3FN2OS and a molecular weight of 315.58 g/mol. Its IUPAC name is 2-fluoro-N-[(2,3,4-trichlorophenyl)carbamothioyl]acetamide.
| Compound Name | 2-fluoro-N-[(2,3,4-trichlorophenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 88814163 |
| Molecular Formula | C9H6Cl3FN2OS |
| Molecular Weight | 315.58 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | 2-fluoro-N-[(2,3,4-trichlorophenyl)carbamothioyl]acetamide |
| SMILES | O=C(CF)NC(=S)Nc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C9H6Cl3FN2OS/c10-4-1-2-5(8(12)7(4)11)14-9(17)15-6(16)3-13/h1-2H,3H2,(H2,14,15,16,17) |
| InChIKey | JDHBKPVRUZBNSC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|