C45H49Cl2FN4O6 — CID 88931773
CID 88931773 (PubChem CID 88931773) has the molecular formula C45H49Cl2FN4O6 and a molecular weight of 831.81 g/mol.
| Compound Name | CID 88931773 |
|---|---|
| PubChem CID | 88931773 |
| Molecular Formula | C45H49Cl2FN4O6 |
| Molecular Weight | 831.81 g/mol |
| Exact Mass | 830.30 |
| IUPAC Name | — |
| SMILES | CO[C@H]1C[C@@H](NC(=O)[C@H]2[C@H](c3ccnc(Cl)c3F)C3(C(=O)Nc4cc(Cl)ccc43)C3(CCC(C)(C)CC3)N2[C@H](c2ccccc2)[C@@H](O)c2ccccc2)CO[C@@H]1CO |
| InChI | InChI=1S/C45H49Cl2FN4O6/c1-43(2)17-19-44(20-18-43)45(31-15-14-28(46)22-32(31)51-42(45)56)35(30-16-21-49-40(47)36(30)48)38(41(55)50-29-23-33(57-3)34(24-53)58-25-29)52(44)37(26-10-6-4-7-11-26)39(54)27-12-8-5-9-13-27/h4-16,21-22,29,33-35,37-39,53-54H,17-20,23-25H2,1-3H3,(H,50,55)(H,51,56)/t29-,33+,34-,35+,37-,38-,39+,45?/m1/s1 |
| InChIKey | XATODQULMXQRDI-LXDLPLJXSA-N |
| XLogP | 7.28 |
| TPSA | 133.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.81 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|