C31H48BF3NO4 — CID 88937585
CID 88937585 (PubChem CID 88937585) has the molecular formula C31H48BF3NO4 and a molecular weight of 566.53 g/mol.
| Compound Name | CID 88937585 |
|---|---|
| PubChem CID | 88937585 |
| Molecular Formula | C31H48BF3NO4 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | — |
| SMILES | CCCCCCCCc1ccc(CCC2(NC(=O)OC(C)(C)C)COC(C)(C)OC2)c(C2[B]C(F)C(F)C2F)c1 |
| InChI | InChI=1S/C31H48BF3NO4/c1-7-8-9-10-11-12-13-21-14-15-22(23(18-21)24-25(33)26(34)27(35)32-24)16-17-31(19-38-30(5,6)39-20-31)36-28(37)40-29(2,3)4/h14-15,18,24-27H,7-13,16-17,19-20H2,1-6H3,(H,36,37) |
| InChIKey | QFRJZNWUVYFYIG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|