C37H55NO5 — CID 66726408
tert-butyl N-[5-[2-[3-(1-adamantyl)-4-octoxyphenyl]ethynyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (PubChem CID 66726408) has the molecular formula C37H55NO5 and a molecular weight of 593.85 g/mol. Its IUPAC name is tert-butyl N-[5-[2-[3-(1-adamantyl)-4-octoxyphenyl]ethynyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[5-[2-[3-(1-adamantyl)-4-octoxyphenyl]ethynyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 66726408 |
| Molecular Formula | C37H55NO5 |
| Molecular Weight | 593.85 g/mol |
| Exact Mass | 593.41 |
| IUPAC Name | tert-butyl N-[5-[2-[3-(1-adamantyl)-4-octoxyphenyl]ethynyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| SMILES | CCCCCCCCOc1ccc(C#CC2(NC(=O)OC(C)(C)C)COC(C)(C)OC2)cc1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C37H55NO5/c1-7-8-9-10-11-12-17-40-32-14-13-27(21-31(32)36-22-28-18-29(23-36)20-30(19-28)24-36)15-16-37(25-41-35(5,6)42-26-37)38-33(39)43-34(2,3)4/h13-14,21,28-30H,7-12,17-20,22-26H2,1-6H3,(H,38,39) |
| InChIKey | QRHLLEFSSPVHOZ-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.85 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|