C18H25NO5S — CID 88972997
ethyl 2-[(4-methylphenyl)sulfonylamino]-2-[(2R,3S)-2-prop-2-enyloxolan-3-yl]acetate (PubChem CID 88972997) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is ethyl 2-[(4-methylphenyl)sulfonylamino]-2-[(2R,3S)-2-prop-2-enyloxolan-3-yl]acetate.
| Compound Name | ethyl 2-[(4-methylphenyl)sulfonylamino]-2-[(2R,3S)-2-prop-2-enyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 88972997 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | ethyl 2-[(4-methylphenyl)sulfonylamino]-2-[(2R,3S)-2-prop-2-enyloxolan-3-yl]acetate |
| SMILES | C=CC[C@H]1OCC[C@H]1C(NS(=O)(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C18H25NO5S/c1-4-6-16-15(11-12-24-16)17(18(20)23-5-2)19-25(21,22)14-9-7-13(3)8-10-14/h4,7-10,15-17,19H,1,5-6,11-12H2,2-3H3/t15-,16-,17?/m1/s1 |
| InChIKey | LMEISTCBSHRITR-YNPPLXCJSA-N |
| XLogP | 2.19 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|