C18H25FN6OS — CID 89000097
N'-(4-tert-butylphenyl)-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-methoxypiperazine-1-carboximidamide (PubChem CID 89000097) has the molecular formula C18H25FN6OS and a molecular weight of 392.50 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-methoxypiperazine-1-carboximidamide.
| Compound Name | N'-(4-tert-butylphenyl)-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-methoxypiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89000097 |
| Molecular Formula | C18H25FN6OS |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N'-(4-tert-butylphenyl)-4-(4-fluoro-1,2,5-thiadiazol-3-yl)-N-methoxypiperazine-1-carboximidamide |
| SMILES | CON/C(=N\c1ccc(C(C)(C)C)cc1)N1CCN(c2nsnc2F)CC1 |
| InChI | InChI=1S/C18H25FN6OS/c1-18(2,3)13-5-7-14(8-6-13)20-17(21-26-4)25-11-9-24(10-12-25)16-15(19)22-27-23-16/h5-8H,9-12H2,1-4H3,(H,20,21) |
| InChIKey | OIUWMOXZPHXDBL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|