C16H19F3N6OS — CID 89000099
N-methoxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide (PubChem CID 89000099) has the molecular formula C16H19F3N6OS and a molecular weight of 400.43 g/mol. Its IUPAC name is N-methoxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide.
| Compound Name | N-methoxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 89000099 |
| Molecular Formula | C16H19F3N6OS |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-methoxy-4-(4-methyl-1,2,5-thiadiazol-3-yl)-N'-[4-(trifluoromethyl)phenyl]piperazine-1-carboximidamide |
| SMILES | CON/C(=N\c1ccc(C(F)(F)F)cc1)N1CCN(c2nsnc2C)CC1 |
| InChI | InChI=1S/C16H19F3N6OS/c1-11-14(23-27-22-11)24-7-9-25(10-8-24)15(21-26-2)20-13-5-3-12(4-6-13)16(17,18)19/h3-6H,7-10H2,1-2H3,(H,20,21) |
| InChIKey | MQVZWAPOBJGEBR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|