C30H28N4O8S — CID 89041567
(2,5-dioxopyrrolidin-1-yl) 6-[[6-amino-9-(2-formylphenyl)-3-iminoxanthen-4-yl]sulfonylamino]hexanoate (PubChem CID 89041567) has the molecular formula C30H28N4O8S and a molecular weight of 604.64 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[[6-amino-9-(2-formylphenyl)-3-iminoxanthen-4-yl]sulfonylamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[[6-amino-9-(2-formylphenyl)-3-iminoxanthen-4-yl]sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 89041567 |
| Molecular Formula | C30H28N4O8S |
| Molecular Weight | 604.64 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[[6-amino-9-(2-formylphenyl)-3-iminoxanthen-4-yl]sulfonylamino]hexanoate |
| SMILES | [H]/N=c1\ccc2c(-c3ccccc3C=O)c3ccc(N)cc3oc-2c1S(=O)(=O)NCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C30H28N4O8S/c31-19-9-10-21-24(16-19)41-29-22(28(21)20-7-4-3-6-18(20)17-35)11-12-23(32)30(29)43(39,40)33-15-5-1-2-8-27(38)42-34-25(36)13-14-26(34)37/h3-4,6-7,9-12,16-17,32-33H,1-2,5,8,13-15,31H2/b32-23+ |
| InChIKey | SFUGMYZGRQVAMZ-AWSUPERCSA-N |
| XLogP | 3.52 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|