C33H41F3 — CID 89045918
2,3-difluoro-1-[(2E,4E)-5-[5-fluoro-2-methyl-4-(4-methylcyclohexyl)phenyl]hepta-2,4-dien-2-yl]-4-[(Z)-hex-2-enyl]benzene (PubChem CID 89045918) has the molecular formula C33H41F3 and a molecular weight of 494.69 g/mol. Its IUPAC name is 2,3-difluoro-1-[(2E,4E)-5-[5-fluoro-2-methyl-4-(4-methylcyclohexyl)phenyl]hepta-2,4-dien-2-yl]-4-[(Z)-hex-2-enyl]benzene.
| Compound Name | 2,3-difluoro-1-[(2E,4E)-5-[5-fluoro-2-methyl-4-(4-methylcyclohexyl)phenyl]hepta-2,4-dien-2-yl]-4-[(Z)-hex-2-enyl]benzene |
|---|---|
| PubChem CID | 89045918 |
| Molecular Formula | C33H41F3 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.32 |
| IUPAC Name | 2,3-difluoro-1-[(2E,4E)-5-[5-fluoro-2-methyl-4-(4-methylcyclohexyl)phenyl]hepta-2,4-dien-2-yl]-4-[(Z)-hex-2-enyl]benzene |
| SMILES | CCC/C=C\Cc1ccc(/C(C)=C/C=C(\CC)c2cc(F)c(C3CCC(C)CC3)cc2C)c(F)c1F |
| InChI | InChI=1S/C33H41F3/c1-6-8-9-10-11-27-18-19-28(33(36)32(27)35)23(4)14-17-25(7-2)29-21-31(34)30(20-24(29)5)26-15-12-22(3)13-16-26/h9-10,14,17-22,26H,6-8,11-13,15-16H2,1-5H3/b10-9-,23-14+,25-17+ |
| InChIKey | KRSWXKFLSRXXMC-ZAVNHXPHSA-N |
| XLogP | 10.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|