C19H21N7O5S2 — CID 89113552
2-[(4S)-6-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)phenyl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine (PubChem CID 89113552) has the molecular formula C19H21N7O5S2 and a molecular weight of 491.56 g/mol. Its IUPAC name is 2-[(4S)-6-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)phenyl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine.
| Compound Name | 2-[(4S)-6-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)phenyl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine |
|---|---|
| PubChem CID | 89113552 |
| Molecular Formula | C19H21N7O5S2 |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | 2-[(4S)-6-[2-(2,1,3-benzothiadiazol-4-ylsulfonylamino)phenyl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine |
| SMILES | NC(N)=NCCC[C@H](NO)C(=O)C(=O)c1ccccc1NS(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C19H21N7O5S2/c20-19(21)22-10-4-8-14(23-29)18(28)17(27)11-5-1-2-6-12(11)26-33(30,31)15-9-3-7-13-16(15)25-32-24-13/h1-3,5-7,9,14,23,26,29H,4,8,10H2,(H4,20,21,22)/t14-/m0/s1 |
| InChIKey | GGEBRAOZEQLQSI-AWEZNQCLSA-N |
| XLogP | 0.64 |
| TPSA | 202.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|