C22H31N5O6S2 — CID 89113549
2-[(4S)-6-[5-tert-butyl-3-[(4-methoxyphenyl)sulfonylamino]thiophen-2-yl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine (PubChem CID 89113549) has the molecular formula C22H31N5O6S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is 2-[(4S)-6-[5-tert-butyl-3-[(4-methoxyphenyl)sulfonylamino]thiophen-2-yl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine.
| Compound Name | 2-[(4S)-6-[5-tert-butyl-3-[(4-methoxyphenyl)sulfonylamino]thiophen-2-yl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine |
|---|---|
| PubChem CID | 89113549 |
| Molecular Formula | C22H31N5O6S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 2-[(4S)-6-[5-tert-butyl-3-[(4-methoxyphenyl)sulfonylamino]thiophen-2-yl]-4-(hydroxyamino)-5,6-dioxohexyl]guanidine |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(C(C)(C)C)sc2C(=O)C(=O)[C@H](CCCN=C(N)N)NO)cc1 |
| InChI | InChI=1S/C22H31N5O6S2/c1-22(2,3)17-12-16(27-35(31,32)14-9-7-13(33-4)8-10-14)20(34-17)19(29)18(28)15(26-30)6-5-11-25-21(23)24/h7-10,12,15,26-27,30H,5-6,11H2,1-4H3,(H4,23,24,25)/t15-/m0/s1 |
| InChIKey | CEQCFKXLWGMKDB-HNNXBMFYSA-N |
| XLogP | 2.01 |
| TPSA | 186.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|