C26H43N3O10 — CID 89121094
4-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 1-O-(2-methylbutan-2-yl) 2-hydroxybutanedioate (PubChem CID 89121094) has the molecular formula C26H43N3O10 and a molecular weight of 557.64 g/mol. Its IUPAC name is 4-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 1-O-(2-methylbutan-2-yl) 2-hydroxybutanedioate.
| Compound Name | 4-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 1-O-(2-methylbutan-2-yl) 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 89121094 |
| Molecular Formula | C26H43N3O10 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | 4-O-[2-hydroxy-3-[3-(2-hydroxy-4,4-dimethylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]propyl] 1-O-(2-methylbutan-2-yl) 2-hydroxybutanedioate |
| SMILES | C=CCn1c(=O)n(CC(O)COC(=O)CC(O)C(=O)OC(C)(C)CC)c(=O)n(CC(O)CC(C)(C)CC)c1=O |
| InChI | InChI=1S/C26H43N3O10/c1-8-11-27-22(35)28(14-17(30)13-25(4,5)9-2)24(37)29(23(27)36)15-18(31)16-38-20(33)12-19(32)21(34)39-26(6,7)10-3/h8,17-19,30-32H,1,9-16H2,2-7H3 |
| InChIKey | AGCKEOZWOCGITR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 179.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|