C16H24N2O — CID 89144825
(2Z,6E,7R,8Z)-5-amino-6-ethylidene-7,9-dimethyl-4-methylideneundeca-2,8,10-trienamide (PubChem CID 89144825) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (2Z,6E,7R,8Z)-5-amino-6-ethylidene-7,9-dimethyl-4-methylideneundeca-2,8,10-trienamide.
| Compound Name | (2Z,6E,7R,8Z)-5-amino-6-ethylidene-7,9-dimethyl-4-methylideneundeca-2,8,10-trienamide |
|---|---|
| PubChem CID | 89144825 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (2Z,6E,7R,8Z)-5-amino-6-ethylidene-7,9-dimethyl-4-methylideneundeca-2,8,10-trienamide |
| SMILES | C=C/C(C)=C\[C@@H](C)/C(=C\C)C(N)C(=C)/C=C\C(N)=O |
| InChI | InChI=1S/C16H24N2O/c1-6-11(3)10-13(5)14(7-2)16(18)12(4)8-9-15(17)19/h6-10,13,16H,1,4,18H2,2-3,5H3,(H2,17,19)/b9-8-,11-10-,14-7+/t13-,16?/m1/s1 |
| InChIKey | CCPAASMWFLOFTM-QRLNTXGWSA-N |
| XLogP | 2.63 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|