C24H35N3O7 — CID 89207654
methyl (Z)-2-amino-3-[7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)hept-1-en-2-yl]oxyprop-2-enoate (PubChem CID 89207654) has the molecular formula C24H35N3O7 and a molecular weight of 477.56 g/mol. Its IUPAC name is methyl (Z)-2-amino-3-[7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)hept-1-en-2-yl]oxyprop-2-enoate.
| Compound Name | methyl (Z)-2-amino-3-[7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)hept-1-en-2-yl]oxyprop-2-enoate |
|---|---|
| PubChem CID | 89207654 |
| Molecular Formula | C24H35N3O7 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | methyl (Z)-2-amino-3-[7-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(phenylmethoxycarbonylamino)hept-1-en-2-yl]oxyprop-2-enoate |
| SMILES | C=C(O/C=C(\N)C(=O)OC)C(CCCCNC(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H35N3O7/c1-17(32-16-19(25)21(28)31-5)20(13-9-10-14-26-22(29)34-24(2,3)4)27-23(30)33-15-18-11-7-6-8-12-18/h6-8,11-12,16,20H,1,9-10,13-15,25H2,2-5H3,(H,26,29)(H,27,30)/b19-16- |
| InChIKey | DDQYLEZCXPPOCF-MNDPQUGUSA-N |
| XLogP | 3.48 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|