C23H23Cl3N2O4 — CID 89207941
[4-[3-[3-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-methoxyphenyl]-4,5-dihydro-1,2-oxazol-5-yl]propoxy]phenyl]methanimine (PubChem CID 89207941) has the molecular formula C23H23Cl3N2O4 and a molecular weight of 497.81 g/mol. Its IUPAC name is [4-[3-[3-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-methoxyphenyl]-4,5-dihydro-1,2-oxazol-5-yl]propoxy]phenyl]methanimine.
| Compound Name | [4-[3-[3-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-methoxyphenyl]-4,5-dihydro-1,2-oxazol-5-yl]propoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 89207941 |
| Molecular Formula | C23H23Cl3N2O4 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | [4-[3-[3-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-methoxyphenyl]-4,5-dihydro-1,2-oxazol-5-yl]propoxy]phenyl]methanimine |
| SMILES | [H]/N=C/c1ccc(OCCCC2CC(c3cc(OCC=C(Cl)Cl)cc(Cl)c3OC)=NO2)cc1 |
| InChI | InChI=1S/C23H23Cl3N2O4/c1-29-23-19(11-18(12-20(23)24)31-10-8-22(25)26)21-13-17(32-28-21)3-2-9-30-16-6-4-15(14-27)5-7-16/h4-8,11-12,14,17,27H,2-3,9-10,13H2,1H3/b27-14+ |
| InChIKey | LQWJCWRZFFNSEU-MZJWZYIUSA-N |
| XLogP | 6.40 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|