C27H32O3 — CID 89232513
(3S,4Z,6E)-6-[(2E,4Z)-hexa-2,4-dien-2-yl]oxy-3-methyl-2-(4-phenoxyphenyl)octa-4,6-dien-2-ol (PubChem CID 89232513) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is (3S,4Z,6E)-6-[(2E,4Z)-hexa-2,4-dien-2-yl]oxy-3-methyl-2-(4-phenoxyphenyl)octa-4,6-dien-2-ol.
| Compound Name | (3S,4Z,6E)-6-[(2E,4Z)-hexa-2,4-dien-2-yl]oxy-3-methyl-2-(4-phenoxyphenyl)octa-4,6-dien-2-ol |
|---|---|
| PubChem CID | 89232513 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (3S,4Z,6E)-6-[(2E,4Z)-hexa-2,4-dien-2-yl]oxy-3-methyl-2-(4-phenoxyphenyl)octa-4,6-dien-2-ol |
| SMILES | C/C=C\C=C(/C)OC(/C=C\[C@H](C)C(C)(O)c1ccc(Oc2ccccc2)cc1)=C/C |
| InChI | InChI=1S/C27H32O3/c1-6-8-12-22(4)29-24(7-2)18-15-21(3)27(5,28)23-16-19-26(20-17-23)30-25-13-10-9-11-14-25/h6-21,28H,1-5H3/b8-6-,18-15-,22-12+,24-7+/t21-,27?/m0/s1 |
| InChIKey | VHEBHQGXUPWZCD-AQHIHJKASA-N |
| XLogP | 7.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|