C30H44O5 — CID 89241234
(3Z,9S,11S,17R)-7-[(E)-3-cyclopent-3-en-1-yl-1-hydroxyprop-2-enyl]-11-hydroxy-9,10-dimethyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,19-dien-5-one (PubChem CID 89241234) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (3Z,9S,11S,17R)-7-[(E)-3-cyclopent-3-en-1-yl-1-hydroxyprop-2-enyl]-11-hydroxy-9,10-dimethyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,19-dien-5-one.
| Compound Name | (3Z,9S,11S,17R)-7-[(E)-3-cyclopent-3-en-1-yl-1-hydroxyprop-2-enyl]-11-hydroxy-9,10-dimethyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,19-dien-5-one |
|---|---|
| PubChem CID | 89241234 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (3Z,9S,11S,17R)-7-[(E)-3-cyclopent-3-en-1-yl-1-hydroxyprop-2-enyl]-11-hydroxy-9,10-dimethyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,19-dien-5-one |
| SMILES | C=C1CCC[C@@H]2CC=CC(C/C=C\C(=O)OC(C(O)/C=C/C3CC=CC3)C[C@H](C)C(C)[C@@H](O)C1)O2 |
| InChI | InChI=1S/C30H44O5/c1-21-9-6-12-25-13-7-14-26(34-25)15-8-16-30(33)35-29(20-22(2)23(3)28(32)19-21)27(31)18-17-24-10-4-5-11-24/h4-5,7-8,14,16-18,22-29,31-32H,1,6,9-13,15,19-20H2,2-3H3/b16-8-,18-17+/t22-,23?,25+,26?,27?,28-,29?/m0/s1 |
| InChIKey | HUKBAFHWALYFKO-OCTSRJQNSA-N |
| XLogP | 5.59 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|