C21H40O6 — CID 89255607
(2R,3R,4R,6S)-3,4-dibutoxy-2-(butoxymethyl)-6-(methoxymethoxy)cyclohexan-1-one (PubChem CID 89255607) has the molecular formula C21H40O6 and a molecular weight of 388.55 g/mol. Its IUPAC name is (2R,3R,4R,6S)-3,4-dibutoxy-2-(butoxymethyl)-6-(methoxymethoxy)cyclohexan-1-one.
| Compound Name | (2R,3R,4R,6S)-3,4-dibutoxy-2-(butoxymethyl)-6-(methoxymethoxy)cyclohexan-1-one |
|---|---|
| PubChem CID | 89255607 |
| Molecular Formula | C21H40O6 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.28 |
| IUPAC Name | (2R,3R,4R,6S)-3,4-dibutoxy-2-(butoxymethyl)-6-(methoxymethoxy)cyclohexan-1-one |
| SMILES | CCCCOC[C@H]1C(=O)[C@@H](OCOC)C[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C21H40O6/c1-5-8-11-24-15-17-20(22)18(27-16-23-4)14-19(25-12-9-6-2)21(17)26-13-10-7-3/h17-19,21H,5-16H2,1-4H3/t17-,18-,19+,21+/m0/s1 |
| InChIKey | PSWAZFKUVJJFAF-CTAFRAEOSA-N |
| XLogP | 3.75 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|