C20H37NO5 — CID 90181875
(2S,3S,5R,6R)-3-butoxy-2-(butoxymethyl)-6-(diethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 90181875) has the molecular formula C20H37NO5 and a molecular weight of 371.52 g/mol. Its IUPAC name is (2S,3S,5R,6R)-3-butoxy-2-(butoxymethyl)-6-(diethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (2S,3S,5R,6R)-3-butoxy-2-(butoxymethyl)-6-(diethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 90181875 |
| Molecular Formula | C20H37NO5 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | (2S,3S,5R,6R)-3-butoxy-2-(butoxymethyl)-6-(diethoxymethyl)-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CCCCOC[C@H]1[C@@H](OCCCC)C[C@@H]2[C@H](C(OCC)OCC)C(=O)N21 |
| InChI | InChI=1S/C20H37NO5/c1-5-9-11-23-14-16-17(26-12-10-6-2)13-15-18(19(22)21(15)16)20(24-7-3)25-8-4/h15-18,20H,5-14H2,1-4H3/t15-,16+,17+,18+/m1/s1 |
| InChIKey | AHSLGZYPFZQACY-OWSLCNJRSA-N |
| XLogP | 2.99 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|