C24H32O12 — CID 89321272
[3-[2-(2-methoxy-2-oxoethoxy)-2-methyl-3-oxopropanoyl]oxy-1-adamantyl] 2-(2-methoxy-2-oxoethoxy)-2-methyl-3-oxopropanoate (PubChem CID 89321272) has the molecular formula C24H32O12 and a molecular weight of 512.51 g/mol. Its IUPAC name is [3-[2-(2-methoxy-2-oxoethoxy)-2-methyl-3-oxopropanoyl]oxy-1-adamantyl] 2-(2-methoxy-2-oxoethoxy)-2-methyl-3-oxopropanoate.
| Compound Name | [3-[2-(2-methoxy-2-oxoethoxy)-2-methyl-3-oxopropanoyl]oxy-1-adamantyl] 2-(2-methoxy-2-oxoethoxy)-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 89321272 |
| Molecular Formula | C24H32O12 |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | [3-[2-(2-methoxy-2-oxoethoxy)-2-methyl-3-oxopropanoyl]oxy-1-adamantyl] 2-(2-methoxy-2-oxoethoxy)-2-methyl-3-oxopropanoate |
| SMILES | COC(=O)COC(C)(C=O)C(=O)OC12CC3CC(C1)CC(OC(=O)C(C)(C=O)OCC(=O)OC)(C3)C2 |
| InChI | InChI=1S/C24H32O12/c1-21(13-25,33-10-17(27)31-3)19(29)35-23-6-15-5-16(7-23)9-24(8-15,12-23)36-20(30)22(2,14-26)34-11-18(28)32-4/h13-16H,5-12H2,1-4H3 |
| InChIKey | BLICPCBEXNXYPY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|