C22H19F3INO — CID 89347606
5-(iodomethyl)-2-[(2S)-1-phenyl-2-[3-(trifluoromethoxy)phenyl]propan-2-yl]pyridine (PubChem CID 89347606) has the molecular formula C22H19F3INO and a molecular weight of 497.30 g/mol. Its IUPAC name is 5-(iodomethyl)-2-[(2S)-1-phenyl-2-[3-(trifluoromethoxy)phenyl]propan-2-yl]pyridine.
| Compound Name | 5-(iodomethyl)-2-[(2S)-1-phenyl-2-[3-(trifluoromethoxy)phenyl]propan-2-yl]pyridine |
|---|---|
| PubChem CID | 89347606 |
| Molecular Formula | C22H19F3INO |
| Molecular Weight | 497.30 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 5-(iodomethyl)-2-[(2S)-1-phenyl-2-[3-(trifluoromethoxy)phenyl]propan-2-yl]pyridine |
| SMILES | C[C@](Cc1ccccc1)(c1cccc(OC(F)(F)F)c1)c1ccc(CI)cn1 |
| InChI | InChI=1S/C22H19F3INO/c1-21(13-16-6-3-2-4-7-16,20-11-10-17(14-26)15-27-20)18-8-5-9-19(12-18)28-22(23,24)25/h2-12,15H,13-14H2,1H3/t21-/m0/s1 |
| InChIKey | ARZDNRVQCFNIBN-NRFANRHFSA-N |
| XLogP | 6.46 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.30 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|