C12H15N5O2 — CID 89348672
(3S,4Z)-5-(6-aminopurin-9-yl)hepta-4,6-diene-1,3-diol (PubChem CID 89348672) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is (3S,4Z)-5-(6-aminopurin-9-yl)hepta-4,6-diene-1,3-diol.
| Compound Name | (3S,4Z)-5-(6-aminopurin-9-yl)hepta-4,6-diene-1,3-diol |
|---|---|
| PubChem CID | 89348672 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (3S,4Z)-5-(6-aminopurin-9-yl)hepta-4,6-diene-1,3-diol |
| SMILES | C=C/C(=C/[C@@H](O)CCO)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C12H15N5O2/c1-2-8(5-9(19)3-4-18)17-7-16-10-11(13)14-6-15-12(10)17/h2,5-7,9,18-19H,1,3-4H2,(H2,13,14,15)/b8-5-/t9-/m0/s1 |
| InChIKey | JTZWAXUHFWELCT-RDOCRHDPSA-N |
| XLogP | 0.18 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|