C12H13NO2 — CID 89360211
4-[(1E,3Z)-1-aminohexa-1,3,5-trien-2-yl]benzene-1,3-diol (PubChem CID 89360211) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-[(1E,3Z)-1-aminohexa-1,3,5-trien-2-yl]benzene-1,3-diol.
| Compound Name | 4-[(1E,3Z)-1-aminohexa-1,3,5-trien-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 89360211 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 4-[(1E,3Z)-1-aminohexa-1,3,5-trien-2-yl]benzene-1,3-diol |
| SMILES | C=C/C=C\C(=C/N)c1ccc(O)cc1O |
| InChI | InChI=1S/C12H13NO2/c1-2-3-4-9(8-13)11-6-5-10(14)7-12(11)15/h2-8,14-15H,1,13H2/b4-3-,9-8+ |
| InChIKey | YYUXTVSLSWAEJE-VHPFQHCPSA-N |
| XLogP | 2.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|