C22H30Cl2IN5O2 — CID 89371573
2-chloro-6-[2-chloro-5-[2-(diethylamino)ethoxy]-4-methylphenyl]-5-N-iodo-4-N-(oxan-2-yl)pyrimidine-4,5-diamine (PubChem CID 89371573) has the molecular formula C22H30Cl2IN5O2 and a molecular weight of 594.33 g/mol. Its IUPAC name is 2-chloro-6-[2-chloro-5-[2-(diethylamino)ethoxy]-4-methylphenyl]-5-N-iodo-4-N-(oxan-2-yl)pyrimidine-4,5-diamine.
| Compound Name | 2-chloro-6-[2-chloro-5-[2-(diethylamino)ethoxy]-4-methylphenyl]-5-N-iodo-4-N-(oxan-2-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 89371573 |
| Molecular Formula | C22H30Cl2IN5O2 |
| Molecular Weight | 594.33 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | 2-chloro-6-[2-chloro-5-[2-(diethylamino)ethoxy]-4-methylphenyl]-5-N-iodo-4-N-(oxan-2-yl)pyrimidine-4,5-diamine |
| SMILES | CCN(CC)CCOc1cc(-c2nc(Cl)nc(NC3CCCCO3)c2NI)c(Cl)cc1C |
| InChI | InChI=1S/C22H30Cl2IN5O2/c1-4-30(5-2)9-11-31-17-13-15(16(23)12-14(17)3)19-20(29-25)21(28-22(24)27-19)26-18-8-6-7-10-32-18/h12-13,18,29H,4-11H2,1-3H3,(H,26,27,28) |
| InChIKey | XMDNQQGNUKYBCX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.33 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|