C25H30ClFN6O5 — CID 89383163
(6S,9aS)-8-[(4-aminooxyphenyl)methyl]-6-(3-chloropropyl)-2-(fluoromethyl)-N-[(4-hydroxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 89383163) has the molecular formula C25H30ClFN6O5 and a molecular weight of 549.00 g/mol. Its IUPAC name is (6S,9aS)-8-[(4-aminooxyphenyl)methyl]-6-(3-chloropropyl)-2-(fluoromethyl)-N-[(4-hydroxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-8-[(4-aminooxyphenyl)methyl]-6-(3-chloropropyl)-2-(fluoromethyl)-N-[(4-hydroxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 89383163 |
| Molecular Formula | C25H30ClFN6O5 |
| Molecular Weight | 549.00 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | (6S,9aS)-8-[(4-aminooxyphenyl)methyl]-6-(3-chloropropyl)-2-(fluoromethyl)-N-[(4-hydroxyphenyl)methyl]-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | NOc1ccc(CN2C[C@H]3N(C(=O)CN(CF)N3C(=O)NCc3ccc(O)cc3)[C@@H](CCCCl)C2=O)cc1 |
| InChI | InChI=1S/C25H30ClFN6O5/c26-11-1-2-21-24(36)30(13-18-5-9-20(38-28)10-6-18)14-22-32(21)23(35)15-31(16-27)33(22)25(37)29-12-17-3-7-19(34)8-4-17/h3-10,21-22,34H,1-2,11-16,28H2,(H,29,37)/t21-,22-/m0/s1 |
| InChIKey | TUIIHMUJXOOOFE-VXKWHMMOSA-N |
| XLogP | 1.90 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.00 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|