C38H54N2O7 — CID 89390819
(2-hex-5-enoxyphenyl)methyl N-[(2R,3S)-3-[2-[(2R,3R)-3-ethyloxolan-2-yl]ethoxycarbonylamino]-2-hydroxy-4-phenylbutyl]-N-pent-4-enylcarbamate (PubChem CID 89390819) has the molecular formula C38H54N2O7 and a molecular weight of 650.86 g/mol. Its IUPAC name is (2-hex-5-enoxyphenyl)methyl N-[(2R,3S)-3-[2-[(2R,3R)-3-ethyloxolan-2-yl]ethoxycarbonylamino]-2-hydroxy-4-phenylbutyl]-N-pent-4-enylcarbamate.
| Compound Name | (2-hex-5-enoxyphenyl)methyl N-[(2R,3S)-3-[2-[(2R,3R)-3-ethyloxolan-2-yl]ethoxycarbonylamino]-2-hydroxy-4-phenylbutyl]-N-pent-4-enylcarbamate |
|---|---|
| PubChem CID | 89390819 |
| Molecular Formula | C38H54N2O7 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | (2-hex-5-enoxyphenyl)methyl N-[(2R,3S)-3-[2-[(2R,3R)-3-ethyloxolan-2-yl]ethoxycarbonylamino]-2-hydroxy-4-phenylbutyl]-N-pent-4-enylcarbamate |
| SMILES | C=CCCCCOc1ccccc1COC(=O)N(CCCC=C)C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OCC[C@H]1OCC[C@H]1CC |
| InChI | InChI=1S/C38H54N2O7/c1-4-7-9-16-24-44-35-20-14-13-19-32(35)29-47-38(43)40(23-15-8-5-2)28-34(41)33(27-30-17-11-10-12-18-30)39-37(42)46-26-22-36-31(6-3)21-25-45-36/h4-5,10-14,17-20,31,33-34,36,41H,1-2,6-9,15-16,21-29H2,3H3,(H,39,42)/t31-,33+,34-,36-/m1/s1 |
| InChIKey | AFTUZCMTMOGFMN-CSXBGTNYSA-N |
| XLogP | 7.23 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|