C18H27N3O4SSi — CID 89395775
(2S,4S)-2-[5-formyl-1-(2-trimethylsilylethoxymethyl)thieno[2,3-d]imidazol-2-yl]-4-methylpyrrolidine-1-carboxylic acid (PubChem CID 89395775) has the molecular formula C18H27N3O4SSi and a molecular weight of 409.58 g/mol. Its IUPAC name is (2S,4S)-2-[5-formyl-1-(2-trimethylsilylethoxymethyl)thieno[2,3-d]imidazol-2-yl]-4-methylpyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4S)-2-[5-formyl-1-(2-trimethylsilylethoxymethyl)thieno[2,3-d]imidazol-2-yl]-4-methylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 89395775 |
| Molecular Formula | C18H27N3O4SSi |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (2S,4S)-2-[5-formyl-1-(2-trimethylsilylethoxymethyl)thieno[2,3-d]imidazol-2-yl]-4-methylpyrrolidine-1-carboxylic acid |
| SMILES | C[C@H]1C[C@@H](c2nc3sc(C=O)cc3n2COCC[Si](C)(C)C)N(C(=O)O)C1 |
| InChI | InChI=1S/C18H27N3O4SSi/c1-12-7-14(20(9-12)18(23)24)16-19-17-15(8-13(10-22)26-17)21(16)11-25-5-6-27(2,3)4/h8,10,12,14H,5-7,9,11H2,1-4H3,(H,23,24)/t12-,14-/m0/s1 |
| InChIKey | ARYRYAIZYCOACP-JSGCOSHPSA-N |
| XLogP | 4.28 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|