C23H27N3O — CID 89419465
(E)-N-methoxy-2-[3-(8-methylidene-6,7-dihydro-5H-quinolin-2-yl)propyl]-6,7-dihydro-5H-quinolin-8-imine (PubChem CID 89419465) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is (E)-N-methoxy-2-[3-(8-methylidene-6,7-dihydro-5H-quinolin-2-yl)propyl]-6,7-dihydro-5H-quinolin-8-imine.
| Compound Name | (E)-N-methoxy-2-[3-(8-methylidene-6,7-dihydro-5H-quinolin-2-yl)propyl]-6,7-dihydro-5H-quinolin-8-imine |
|---|---|
| PubChem CID | 89419465 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (E)-N-methoxy-2-[3-(8-methylidene-6,7-dihydro-5H-quinolin-2-yl)propyl]-6,7-dihydro-5H-quinolin-8-imine |
| SMILES | C=C1CCCc2ccc(CCCc3ccc4c(n3)/C(=N/OC)CCC4)nc21 |
| InChI | InChI=1S/C23H27N3O/c1-16-6-3-7-17-12-14-19(24-22(16)17)9-5-10-20-15-13-18-8-4-11-21(26-27-2)23(18)25-20/h12-15H,1,3-11H2,2H3/b26-21+ |
| InChIKey | KEPSEYXUVCFOAV-YYADALCUSA-N |
| XLogP | 4.69 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|